CAS 904310-61-8 appears in our catalog under these names: 2-Chloro-4-(pyridin-2-yl)benzoic acid, 95%, 2–Chloro–4–(pyridin–2–yl)benzoic acid, 2-Chloro-4-(pyridin-2-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-4-pyridin-2-ylbenzoic acid (CAS 904310-61-8) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 2-chloro-4-pyridin-2-ylbenzoic acid. InChIKey: XFFDLHWFACHDPI-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 2-chloro-4-pyridin-2-ylbenzoic acid |
| InChIKey | XFFDLHWFACHDPI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)