CAS 887982-21-0 appears in our catalog under these names: 6-(2-Chlorophenyl)picolinic acid, 95%, 6–(2–Chlorophenyl)–2–pyridinecarboxylic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
6-(2-chlorophenyl)pyridine-2-carboxylic acid (CAS 887982-21-0) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 6-(2-chlorophenyl)pyridine-2-carboxylic acid. InChIKey: NRJFTQTUUVDZMD-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 6-(2-chlorophenyl)pyridine-2-carboxylic acid |
| InChIKey | NRJFTQTUUVDZMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CC=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)