cas: 675576-26-8 — see every product listed under this CAS number, including other names
6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOQUINOLINE, 97% (CAS 675576-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F827081-100MG |
| cas | 675576-26-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 3423.81 Pln | |
| Fluorochem | 10g | 5220.05 Pln | |
| Fluorochem | 25g | 10374.49 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (CAS 675576-26-8) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline. InChIKey: LFALMDZWCMSBFO-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| InChIKey | LFALMDZWCMSBFO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NC=C3 |
Computed by PubChem (NCBI)