cas: 1155264-46-2 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-benzo[b][1,4]oxazine, 97% (CAS 1155264-46-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F385132-100MG |
| cas | 1155264-46-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (CAS 1155264-46-2) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: HFUHUNYUUCDCAU-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | HFUHUNYUUCDCAU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)OCCN3 |
Computed by PubChem (NCBI)