cas: 1002309-47-8 — see every product listed under this CAS number, including other names
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]thiazole, 97% (CAS 1002309-47-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233526-100MG |
| cas | 1002309-47-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1325.59 Pln | |
| Fluorochem | 10g | 2590.77 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (CAS 1002309-47-8) is a chemical compound with the molecular formula C13H16BNO2S and a molecular weight of 261.2 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole. InChIKey: VLJNKSRMMHATGX-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2S |
|---|---|
| Molecular weight | 261.2 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| InChIKey | VLJNKSRMMHATGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)