CAS 1073354-91-2 appears in our catalog under these names: 5–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)benzo(d)thiazole, Benzothiazole-5-boronic acid pinacol ester, Benzothiazole-5-boronic acid pinacol ester 97%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl),benzo[d]thiazole, 97%, 97%, Benzothiazole-5-boronic acid pinacol ester, 98.0%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 500mg, 250mg, 5g, 10g, 25g, 100g, 100mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (CAS 1073354-91-2) is a chemical compound with the molecular formula C13H16BNO2S and a molecular weight of 261.2 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole. InChIKey: MGOKEBHEDJCRQN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2S |
|---|---|
| Molecular weight | 261.2 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| InChIKey | MGOKEBHEDJCRQN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)SC=N3 |
Computed by PubChem (NCBI)