Products 2096337-96-9
CAS 2096337-96-9 appears in our catalog under these names: 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo(c)isothiazole, 95%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo(C)isothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1-benzothiazole (CAS 2096337-96-9) is a chemical compound with the molecular formula C13H16BNO2S and a molecular weight of 261.2 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1-benzothiazole. InChIKey: HOLSSEGFCIOQOI-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO2S |
|---|---|
| Molecular weight | 261.2 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1-benzothiazole |
| InChIKey | HOLSSEGFCIOQOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CSN=C3C=C2 |
Computed by PubChem (NCBI)