cas: 201809-22-5 — see every product listed under this CAS number, including other names
6-(4-(tert-Butoxycarbonyl)piperazin-1-yl)nicotinic acid, 97% (CAS 201809-22-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F460905-1G |
| cas | 201809-22-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1664.02 Pln | |
| Fluorochem | 500mg | 1127.75 Pln | |
| Fluorochem | 5g | 4767.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-3-carboxylic acid (CAS 201809-22-5) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: 6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-3-carboxylic acid. InChIKey: PWYGTZUOLAGDNK-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | 6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-3-carboxylic acid |
| InChIKey | PWYGTZUOLAGDNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)