cas: 1448427-99-3 — see every product listed under this CAS number, including other names
6-(4-Isopropyl-4H-1,2,4-triazol-3-yl)pyridin-2-amine, 95%, 95% (CAS 1448427-99-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABQ9-100mg |
| cas | 1448427-99-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1422.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridin-2-amine (CAS 1448427-99-3) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridin-2-amine. InChIKey: MPBBJHFKDHDIRZ-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 6-(4-propan-2-yl-1,2,4-triazol-3-yl)pyridin-2-amine |
| InChIKey | MPBBJHFKDHDIRZ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NN=C1C2=NC(=CC=C2)N |
Computed by PubChem (NCBI)