CAS 1249585-67-8 appears in our catalog under these names: 1-(4,6-Dimethylpyrimidin-2-yl)-5-methyl-1H-pyrazol-3-amine, 98%, 1-(4,6-Dimethylpyrimidin-2-yl)-5-methyl-1H-pyrazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-amine (CAS 1249585-67-8) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 1-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-amine. InChIKey: KNAYSOLLOXMFBT-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-amine |
| InChIKey | KNAYSOLLOXMFBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2C(=CC(=N2)N)C)C |
Computed by PubChem (NCBI)