CAS 956711-44-7 appears in our catalog under these names: 1-(2,6-Dimethylpyrimidin-4-yl)-3-methyl-1H-pyrazol-5-amine, 95%, 1-(2,6-Dimethylpyrimidin-4-yl)-3-methyl-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,6-dimethylpyrimidin-4-yl)-5-methylpyrazol-3-amine (CAS 956711-44-7) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 2-(2,6-dimethylpyrimidin-4-yl)-5-methylpyrazol-3-amine. InChIKey: TVPSRLKEWQZEBQ-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-(2,6-dimethylpyrimidin-4-yl)-5-methylpyrazol-3-amine |
| InChIKey | TVPSRLKEWQZEBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C)N2C(=CC(=N2)C)N |
Computed by PubChem (NCBI)