CAS 910443-59-3 appears in our catalog under these names: 5-(3-(Dimethylamino)phenyl)-4H-1,2,4-triazol-3-amine, 5-(3-(Dimethylamino)phenyl)-4h-1,2,4-triazol-3-amine, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-[3-(dimethylamino)phenyl]-1H-1,2,4-triazol-3-amine (CAS 910443-59-3) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 5-[3-(dimethylamino)phenyl]-1H-1,2,4-triazol-3-amine. InChIKey: RAUVQYPWYWAFLR-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 5-[3-(dimethylamino)phenyl]-1H-1,2,4-triazol-3-amine |
| InChIKey | RAUVQYPWYWAFLR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC(=C1)C2=NC(=NN2)N |
Computed by PubChem (NCBI)