cas: 1257553-74-4 — see every product listed under this CAS number, including other names
6-(Aminocarbonyl)pyridine-3-boronic acid pinacol ester, 97%, 97% (CAS 1257553-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OMW-100mg |
| cas | 1257553-74-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 5g | 3938.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 1257553-74-4) is a chemical compound with the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: NRPJHELKCIKBLE-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O3 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | NRPJHELKCIKBLE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)