CAS 374927-12-5 appears in our catalog under these names: (4-(4-Methylpiperazine-1-carbonyl)phenyl)boronic acid, 95-<97%, (4-(4-Methylpiperazine-1-carbonyl)phenyl)boronic acid, 95+%. Offered by: Hoffman Fine Chemicals, AmBeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 1g, 250mg.
[4-(4-methylpiperazine-1-carbonyl)phenyl]boronic acid (CAS 374927-12-5) is a chemical compound with the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. IUPAC name: [4-(4-methylpiperazine-1-carbonyl)phenyl]boronic acid. InChIKey: ILNVLRZFTJYYCF-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O3 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | [4-(4-methylpiperazine-1-carbonyl)phenyl]boronic acid |
| InChIKey | ILNVLRZFTJYYCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)