Products 2223045-63-2
CAS 2223045-63-2 is the registry number for 1-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]ethanone (CAS 2223045-63-2) is a chemical compound with the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. IUPAC name: 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]ethanone. InChIKey: JLUXCOGBFPMPIE-UHFFFAOYSA-N.
| Molecular formula | C12H17BN2O3 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]ethanone |
| InChIKey | JLUXCOGBFPMPIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C(=O)C |
Computed by PubChem (NCBI)