Products 7568-08-3
CAS 7568-08-3 is the registry number for 2,6-Naphthalenedicarboxylic acid, 2-methyl ester, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
6-methoxycarbonylnaphthalene-2-carboxylic acid (CAS 7568-08-3) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 6-methoxycarbonylnaphthalene-2-carboxylic acid. InChIKey: SKTKMAWOMQFTNS-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 6-methoxycarbonylnaphthalene-2-carboxylic acid |
| InChIKey | SKTKMAWOMQFTNS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-(methoxycarbonyl)naphthalene-2-carboxylic acid, 6-(Methoxycarbonyl)-2-naphthoic acid, 2,6-Naphthalenedicarboxylic acid, monomethyl ester, 6-methoxycarbonylnaphthalene-2-carboxylic acid, 2,6-Naphthalenedicarboxylic acid, 2-methyl ester, monomethyl 2,6-naphthalenedicarboxylate, Monomethyl naphthalene-2,6-dicarboxylate, Methyl 6-carboxy-2-naphthalenecarboxylate, ChemDiv2_000140, 6-(Methoxycarbonyl)-2-naphthoicacid