cas: 904326-93-8 — see every product listed under this CAS number, including other names
6-(Morpholino)pyridine-3-boronic Acid (contains varying amounts of Anhydride) (CAS 904326-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2967-1G |
| cas | 904326-93-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 349.46 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(6-morpholin-4-yl-3-pyridinyl)boronic acid (CAS 904326-93-8) is a chemical compound with the molecular formula C9H13BN2O3 and a molecular weight of 208.02 g/mol. IUPAC name: (6-morpholin-4-yl-3-pyridinyl)boronic acid. InChIKey: FFPQELNXDVTLEW-UHFFFAOYSA-N.
| Molecular formula | C9H13BN2O3 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (6-morpholin-4-yl-3-pyridinyl)boronic acid |
| InChIKey | FFPQELNXDVTLEW-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)