CAS 2246616-92-0 appears in our catalog under these names: (3-Methyl-4-[(methylcarbamoyl)amino]phenyl)boronic acid, 95%, (3-Methyl-4-(3-methylureido)phenyl)boronic acid, 98%, 3–methyl–4–(3–methylureido)phenylboronic acid, (3-Methyl-4-(3-methylureido)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 25mg.
[3-methyl-4-(methylcarbamoylamino)phenyl]boronic acid (CAS 2246616-92-0) is a chemical compound with the molecular formula C9H13BN2O3 and a molecular weight of 208.02 g/mol. IUPAC name: [3-methyl-4-(methylcarbamoylamino)phenyl]boronic acid. InChIKey: IBZOIHCUKYNYSY-UHFFFAOYSA-N.
| Molecular formula | C9H13BN2O3 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [3-methyl-4-(methylcarbamoylamino)phenyl]boronic acid |
| InChIKey | IBZOIHCUKYNYSY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC(=O)NC)C)(O)O |
Computed by PubChem (NCBI)