CAS 957034-83-2 is the registry number for 4-(3-Hydrazinyl-3-oxopropyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
[4-(3-hydrazinyl-3-oxopropyl)phenyl]boronic acid (CAS 957034-83-2) is a chemical compound with the molecular formula C9H13BN2O3 and a molecular weight of 208.02 g/mol. IUPAC name: [4-(3-hydrazinyl-3-oxopropyl)phenyl]boronic acid. InChIKey: CHMVRIUROYAQAT-UHFFFAOYSA-N.
| Molecular formula | C9H13BN2O3 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [4-(3-hydrazinyl-3-oxopropyl)phenyl]boronic acid |
| InChIKey | CHMVRIUROYAQAT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCC(=O)NN)(O)O |
Computed by PubChem (NCBI)