Products 957034-83-2

CAS 957034-83-2 is the registry number for 4-(3-Hydrazinyl-3-oxopropyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-(3-hydrazinyl-3-oxopropyl)phenyl]boronic acid (CAS 957034-83-2) is a chemical compound with the molecular formula C9H13BN2O3 and a molecular weight of 208.02 g/mol. IUPAC name: [4-(3-hydrazinyl-3-oxopropyl)phenyl]boronic acid. InChIKey: CHMVRIUROYAQAT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BN2O3
Molecular weight208.02 g/mol
IUPAC name[4-(3-hydrazinyl-3-oxopropyl)phenyl]boronic acid
InChIKeyCHMVRIUROYAQAT-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)CCC(=O)NN)(O)O

Computed by PubChem (NCBI)