Products 2241875-82-9
CAS 2241875-82-9 is the registry number for (2–(morpholino–d8)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-4-pyridinyl]boronic acid (CAS 2241875-82-9) is a chemical compound with the molecular formula C9H13BN2O3 and a molecular weight of 216.07 g/mol. IUPAC name: [2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-4-pyridinyl]boronic acid. InChIKey: RRYCUINOUZEQSU-SQUIKQQTSA-N.
| Molecular formula | C9H13BN2O3 |
|---|---|
| Molecular weight | 216.07 g/mol |
| IUPAC name | [2-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)-4-pyridinyl]boronic acid |
| InChIKey | RRYCUINOUZEQSU-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(OC(C(N1C2=NC=CC(=C2)B(O)O)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)