cas: 877041-47-9 — see every product listed under this CAS number, including other names
6-(TERT-BUTYL) 3-METHYL 2-AMINO-4,7-DIHYDROTHIENO[2,3-C]PYRIDINE-3,6(5H)-DICARBOXYLATE, 95%, 95% (CAS 877041-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEQB-100mg |
| cas | 877041-47-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1125.20 Pln | |
| Chemat | 25g | 2186.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-O-tert-butyl 3-O-methyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (CAS 877041-47-9) is a chemical compound with the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. IUPAC name: 6-O-tert-butyl 3-O-methyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate. InChIKey: LGHKBJKZINPCMI-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4S |
|---|---|
| Molecular weight | 312.39 g/mol |
| IUPAC name | 6-O-tert-butyl 3-O-methyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| InChIKey | LGHKBJKZINPCMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=C2C(=O)OC)N |
Computed by PubChem (NCBI)