cas: 131106-70-2 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)benzo[d]thiazole, 96%, 96% (CAS 131106-70-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C53-100mg |
| cas | 131106-70-2 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1216.40 Pln | |
| Chemat | 5g | 3088.40 Pln | |
| Chemat | 10g | 5205.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)-1,3-benzothiazole (CAS 131106-70-2) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 6-(trifluoromethyl)-1,3-benzothiazole. InChIKey: BULNNISVPSQIFO-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1,3-benzothiazole |
| InChIKey | BULNNISVPSQIFO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)SC=N2 |
Computed by PubChem (NCBI)