CAS 90348-21-3 is the registry number for 1-Thiocyanato-4-(trifluoromethyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
[4-(trifluoromethyl)phenyl] thiocyanate (CAS 90348-21-3) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl] thiocyanate. InChIKey: WRBJDWSTNUOWMF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl] thiocyanate |
| InChIKey | WRBJDWSTNUOWMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)SC#N |
Computed by PubChem (NCBI)