CAS 332-26-3 appears in our catalog under these names: 4-(Trifluoromethylthio)benzonitrile, 95%, 4-(Trifluoromethylthio)benzonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 50g, 5g, 10g, 25g, 100g, 250g.
4-(trifluoromethylsulfanyl)benzonitrile (CAS 332-26-3) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 4-(trifluoromethylsulfanyl)benzonitrile. InChIKey: ONQNILXHGUBPPM-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 4-(trifluoromethylsulfanyl)benzonitrile |
| InChIKey | ONQNILXHGUBPPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)SC(F)(F)F |
Computed by PubChem (NCBI)