CAS 14468-40-7 is the registry number for 2-(Trifluoromethyl)benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(trifluoromethyl)-1,3-benzothiazole (CAS 14468-40-7) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzothiazole. InChIKey: TWIPCCMPIAFOKZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzothiazole |
| InChIKey | TWIPCCMPIAFOKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(F)(F)F |
Computed by PubChem (NCBI)