cas: 16544-67-5 — see every product listed under this CAS number, including other names
6-(Trifluoromethyl)quinazolin-4(1H)-one, 96%, 96% (CAS 16544-67-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112W63-250mg |
| cas | 16544-67-5 |
| size | 250mg |
| availability | 9.008g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1331.60 Pln | |
| Chemat | 100mg | 98.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-(trifluoromethyl)-3H-quinazolin-4-one (CAS 16544-67-5) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 6-(trifluoromethyl)-3H-quinazolin-4-one. InChIKey: PTVVXBQQOLLVJP-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-3H-quinazolin-4-one |
| InChIKey | PTVVXBQQOLLVJP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)NC=N2 |
Computed by PubChem (NCBI)