cas: 1414958-13-6 — see every product listed under this CAS number, including other names
6-Amino-2-aza-spiro[3.3]heptane-2-carboxylic acid tert-butyl ester HCl 96% (CAS 1414958-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A672528-100mg |
| cas | 1414958-13-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 2534.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A672528 |
Tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;hydrochloride (CAS 1414958-13-6) is a chemical compound with the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. IUPAC name: tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;hydrochloride. InChIKey: CSFXHBHICSYCIJ-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O2 |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | tert-butyl 6-amino-2-azaspiro[3.3]heptane-2-carboxylate;hydrochloride |
| InChIKey | CSFXHBHICSYCIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)N.Cl |
Computed by PubChem (NCBI)