cas: 3030-19-1 — see every product listed under this CAS number, including other names
6-Amino-3-bromo-2-chlorobenzoic acid 97% (CAS 3030-19-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A992303-100mg |
| cas | 3030-19-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 3140.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A992303 |
6-amino-3-bromo-2-chlorobenzoic acid (CAS 3030-19-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 6-amino-3-bromo-2-chlorobenzoic acid. InChIKey: AQQXRSNOIQEAMM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 6-amino-3-bromo-2-chlorobenzoic acid |
| InChIKey | AQQXRSNOIQEAMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)