cas: 878160-17-9 — see every product listed under this CAS number, including other names
6-Amino-7-methoxy-4-methyl-2H-1,4-benzoxazin-3(4H)-one, 95%, 95% (CAS 878160-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FV4X-100mg |
| cas | 878160-17-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1302.80 Pln | |
| Chemat | 250mg | 2085.20 Pln | |
| Chemat | 1g | 4749.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-amino-7-methoxy-4-methyl-1,4-benzoxazin-3-one (CAS 878160-17-9) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 6-amino-7-methoxy-4-methyl-1,4-benzoxazin-3-one. InChIKey: VMLABVHRKWDMOF-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-amino-7-methoxy-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | VMLABVHRKWDMOF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C(=C2)OC)N |
Computed by PubChem (NCBI)