cas: 850413-36-4 — see every product listed under this CAS number, including other names
6-BROMO-4,4'-DIMETHYL-2,2'-BIPYRIDYL, 97% (CAS 850413-36-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F827945-100MG |
| cas | 850413-36-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 706.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-4-methyl-6-(4-methyl-2-pyridinyl)pyridine (CAS 850413-36-4) is a chemical compound with the molecular formula C12H11BrN2 and a molecular weight of 263.13 g/mol. IUPAC name: 2-bromo-4-methyl-6-(4-methyl-2-pyridinyl)pyridine. InChIKey: UEJJXCRFGURPDR-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2 |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 2-bromo-4-methyl-6-(4-methyl-2-pyridinyl)pyridine |
| InChIKey | UEJJXCRFGURPDR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC(=CC(=C2)C)Br |
Computed by PubChem (NCBI)