cas: 850413-36-4 — see every product listed under this CAS number, including other names
6-Bromo-4,4'-dimethyl-2,2'-bipyridine 97% (CAS 850413-36-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A637810-100mg |
| cas | 850413-36-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1215.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A637810 |
2-bromo-4-methyl-6-(4-methyl-2-pyridinyl)pyridine (CAS 850413-36-4) is a chemical compound with the molecular formula C12H11BrN2 and a molecular weight of 263.13 g/mol. IUPAC name: 2-bromo-4-methyl-6-(4-methyl-2-pyridinyl)pyridine. InChIKey: UEJJXCRFGURPDR-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2 |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 2-bromo-4-methyl-6-(4-methyl-2-pyridinyl)pyridine |
| InChIKey | UEJJXCRFGURPDR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC(=CC(=C2)C)Br |
Computed by PubChem (NCBI)