cas: 1154740-67-6 — see every product listed under this CAS number, including other names
6-BROMO-5-CHLORO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE, 97% (CAS 1154740-67-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F473964-100MG |
| cas | 1154740-67-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1294.35 Pln | |
| Fluorochem | 250mg | 2106.57 Pln | |
| Fluorochem | 500mg | 3449.84 Pln | |
| Fluorochem | 1g | 5141.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-5-chloro-3,4-dihydro-2H-1,4-benzoxazine (CAS 1154740-67-6) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 6-bromo-5-chloro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: OGTVWQTXPBZUTD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 6-bromo-5-chloro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | OGTVWQTXPBZUTD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)