cas: 1154740-67-6 — see every product listed under this CAS number, including other names
6-Bromo-5-chloro-3,4-dihydro-2H-benzo(b)(1,4)oxazine, 97% (CAS 1154740-67-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A536171-5g |
| cas | 1154740-67-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16592.38 Pln | |
| AmBeed | 10g | 27607.30 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-5-chloro-3,4-dihydro-2H-1,4-benzoxazine (CAS 1154740-67-6) is a chemical compound with the molecular formula C8H7BrClNO and a molecular weight of 248.50 g/mol. IUPAC name: 6-bromo-5-chloro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: OGTVWQTXPBZUTD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO |
|---|---|
| Molecular weight | 248.50 g/mol |
| IUPAC name | 6-bromo-5-chloro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | OGTVWQTXPBZUTD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)