cas: 181124-40-3 — see every product listed under this CAS number, including other names
6-Benzothiazolesulfonyl chloride, 97% (CAS 181124-40-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033233-250MG |
| cas | 181124-40-3 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 2.5g | 367.60 Pln | |
| Fluorochem | 5g | 492.55 Pln | |
| Fluorochem | 10g | 773.70 Pln | |
| Fluorochem | 25g | 1835.83 Pln | |
| Fluorochem | 100g | 4886.84 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1,3-benzothiazole-6-sulfonyl chloride (CAS 181124-40-3) is a chemical compound with the molecular formula C7H4ClNO2S2 and a molecular weight of 233.7 g/mol. IUPAC name: 1,3-benzothiazole-6-sulfonyl chloride. InChIKey: XQOLJTWXFUSVOR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S2 |
|---|---|
| Molecular weight | 233.7 g/mol |
| IUPAC name | 1,3-benzothiazole-6-sulfonyl chloride |
| InChIKey | XQOLJTWXFUSVOR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)SC=N2 |
Computed by PubChem (NCBI)