CAS 1936220-93-7 appears in our catalog under these names: Thieno(2,3-c)pyridine-4-sulfonyl chloride, 95%, Thieno(2,3-c)pyridine-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Thieno[2,3-c]pyridine-4-sulfonyl chloride (CAS 1936220-93-7) is a chemical compound with the molecular formula C7H4ClNO2S2 and a molecular weight of 233.7 g/mol. IUPAC name: thieno[2,3-c]pyridine-4-sulfonyl chloride. InChIKey: MFDSPXIKGVGKAW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S2 |
|---|---|
| Molecular weight | 233.7 g/mol |
| IUPAC name | thieno[2,3-c]pyridine-4-sulfonyl chloride |
| InChIKey | MFDSPXIKGVGKAW-UHFFFAOYSA-N |
| SMILES | C1=CSC2=CN=CC(=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)