CAS 1191545-48-8 is the registry number for Thieno(2,3-c)pyridine-2-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Thieno[2,3-c]pyridine-2-sulfonyl chloride (CAS 1191545-48-8) is a chemical compound with the molecular formula C7H4ClNO2S2 and a molecular weight of 233.7 g/mol. IUPAC name: thieno[2,3-c]pyridine-2-sulfonyl chloride. InChIKey: QUZWGNJTEOPBGN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S2 |
|---|---|
| Molecular weight | 233.7 g/mol |
| IUPAC name | thieno[2,3-c]pyridine-2-sulfonyl chloride |
| InChIKey | QUZWGNJTEOPBGN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)