CAS 149575-65-5 appears in our catalog under these names: 1,3-Benzothiazole-4-sulfonyl Chloride, Benzo[d]thiazole-4-sulfonyl chloride 95%, Benzo[d]thiazole-4-sulfonyl chloride, 98%. Offered by: TRC, Ambeed, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g.
1,3-benzothiazole-4-sulfonyl chloride (CAS 149575-65-5) is a chemical compound with the molecular formula C7H4ClNO2S2 and a molecular weight of 233.7 g/mol. IUPAC name: 1,3-benzothiazole-4-sulfonyl chloride. InChIKey: IAHKZUNYBBKBDO-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S2 |
|---|---|
| Molecular weight | 233.7 g/mol |
| IUPAC name | 1,3-benzothiazole-4-sulfonyl chloride |
| InChIKey | IAHKZUNYBBKBDO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CS2 |
Computed by PubChem (NCBI)