cas: 874668-62-9 — see every product listed under this CAS number, including other names
6-Benzyloxy-1H-indazole, >95%, >95% (CAS 874668-62-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MZP-250mg |
| cas | 874668-62-9 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1086.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
6-phenylmethoxy-1H-indazole (CAS 874668-62-9) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 6-phenylmethoxy-1H-indazole. InChIKey: PMKBUGNQHOFKQS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 6-phenylmethoxy-1H-indazole |
| InChIKey | PMKBUGNQHOFKQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C=NN3 |
Computed by PubChem (NCBI)