cas: 1196153-28-2 — see every product listed under this CAS number, including other names
6-Bromo-2,2-dimethyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one, ≥95%, ≥95% (CAS 1196153-28-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1105OS-100mg |
| cas | 1196153-28-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 722.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 1196153-28-2) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: HFSFEKROFQCDII-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | HFSFEKROFQCDII-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=N2)Br)C |
Computed by PubChem (NCBI)