CAS 912760-74-8 appears in our catalog under these names: 3-(2-Amino-5-bromo-pyridin-3-yl)-acrylic acid methyl ester, 95%, Methyl 3-(2-amino-5-bromopyridin-3-yl)acrylate, 97%, 3-(2-Amino-5-bromo-pyridin-3-yl)-acrylic acidmethyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 50mg.
Methyl (E)-3-(2-amino-5-bromo-3-pyridinyl)prop-2-enoate (CAS 912760-74-8) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: methyl (E)-3-(2-amino-5-bromo-3-pyridinyl)prop-2-enoate. InChIKey: WJNCXHOWXDOKDL-NSCUHMNNSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | methyl (E)-3-(2-amino-5-bromo-3-pyridinyl)prop-2-enoate |
| InChIKey | WJNCXHOWXDOKDL-NSCUHMNNSA-N |
| SMILES | COC(=O)/C=C/C1=C(N=CC(=C1)Br)N |
Computed by PubChem (NCBI)