CAS 887351-39-5 appears in our catalog under these names: N-Cyclopropyl 4-bromo-2-nitroaniline, 98%, N-Cyclopropyl 4-bromo-2-nitroaniline, 4-Bromo-N-cyclopropyl-2-nitroaniline, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 25g, 5g, 2,5g.
4-bromo-N-cyclopropyl-2-nitroaniline (CAS 887351-39-5) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: 4-bromo-N-cyclopropyl-2-nitroaniline. InChIKey: HECMECYWHMUTJV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 4-bromo-N-cyclopropyl-2-nitroaniline |
| InChIKey | HECMECYWHMUTJV-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)