CAS 2169906-67-4 is the registry number for 7-Bromo-3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 2169906-67-4) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: 7-bromo-3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: PCJFREOEHIOWBG-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 7-bromo-3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | PCJFREOEHIOWBG-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)N=CC(=C2)Br)C |
Computed by PubChem (NCBI)