6-Bromo-2-chloronicotinic acid, 97%
cas: 1060815-67-9 — see every product listed under this CAS number, including other names
6-Bromo-2-chloronicotinic acid, 97% (CAS 1060815-67-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-5903-1g |
| cas | 1060815-67-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1015.62 Pln | |
| Ambeed | 5g | 2901.31 Pln | |
| Ambeed | 25g | 11884.75 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 2416.40 Pln | |
| Chemat | 10g | 4077.20 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 514.29 Pln | |
| BLDpharm | 1g | 1091.86 Pln | |
| BLDpharm | 5g | 3124.48 Pln | |
| BLDpharm | 25g | 12809.96 Pln | |
| Fluorochem | 25g | 10489.03 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 492.55 Pln | |
| Fluorochem | 1g | 1023.62 Pln | |
| Fluorochem | 5g | 2986.47 Pln | |
| Fluorochem | 10g | 5381.46 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
6-bromo-2-chloropyridine-3-carboxylic acid (CAS 1060815-67-9) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 6-bromo-2-chloropyridine-3-carboxylic acid. InChIKey: CSHIGVLXOXJJMY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 6-bromo-2-chloropyridine-3-carboxylic acid |
| InChIKey | CSHIGVLXOXJJMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)Br |
Computed by PubChem (NCBI)