cas: 37390-63-9 — see every product listed under this CAS number, including other names
6-Bromo-2-hydrazinylbenzo[d]thiazole 95+% (CAS 37390-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A329434-100mg |
| cas | 37390-63-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 926.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A329434 |
(6-bromo-1,3-benzothiazol-2-yl)hydrazine (CAS 37390-63-9) is a chemical compound with the molecular formula C7H6BrN3S and a molecular weight of 244.11 g/mol. IUPAC name: (6-bromo-1,3-benzothiazol-2-yl)hydrazine. InChIKey: YWLCJGPJVPUESW-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3S |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (6-bromo-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | YWLCJGPJVPUESW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=N2)NN |
Computed by PubChem (NCBI)