CAS 502133-10-0 appears in our catalog under these names: 3-(5-Bromothiophen-2-yl)-1h-pyrazol-5-amine, 95%, 3-(5-bromothiophen-2-yl)-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-(5-bromothiophen-2-yl)-1H-pyrazol-3-amine (CAS 502133-10-0) is a chemical compound with the molecular formula C7H6BrN3S and a molecular weight of 244.11 g/mol. IUPAC name: 5-(5-bromothiophen-2-yl)-1H-pyrazol-3-amine. InChIKey: IMSSZTMAIXSKJJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3S |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 5-(5-bromothiophen-2-yl)-1H-pyrazol-3-amine |
| InChIKey | IMSSZTMAIXSKJJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=CC(=NN2)N |
Computed by PubChem (NCBI)