CAS 37390-63-9 appears in our catalog under these names: 6-Bromo-2-hydrazino-1,3-benzothiazole, 95%, 6-Bromo-2-hydrazinylbenzo(d)thiazole, 95+%, 6-Bromo-2-hydrazinylbenzo[d]thiazole 95+%, 6-Bromo-2-hydrazino-1,3-benzothiazole, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(6-bromo-1,3-benzothiazol-2-yl)hydrazine (CAS 37390-63-9) is a chemical compound with the molecular formula C7H6BrN3S and a molecular weight of 244.11 g/mol. IUPAC name: (6-bromo-1,3-benzothiazol-2-yl)hydrazine. InChIKey: YWLCJGPJVPUESW-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3S |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (6-bromo-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | YWLCJGPJVPUESW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=N2)NN |
Computed by PubChem (NCBI)