cas: 37390-63-9 — see every product listed under this CAS number, including other names
6-Bromo-2-hydrazino-1,3-benzothiazole, 95+%, 95+% (CAS 37390-63-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C6OV-100mg |
| cas | 37390-63-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1038.80 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(6-bromo-1,3-benzothiazol-2-yl)hydrazine (CAS 37390-63-9) is a chemical compound with the molecular formula C7H6BrN3S and a molecular weight of 244.11 g/mol. IUPAC name: (6-bromo-1,3-benzothiazol-2-yl)hydrazine. InChIKey: YWLCJGPJVPUESW-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3S |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (6-bromo-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | YWLCJGPJVPUESW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=N2)NN |
Computed by PubChem (NCBI)