cas: 1451391-32-4 — see every product listed under this CAS number, including other names
6-Bromo-2-methylpyridine-3-boronic acid pinacol ester, 97% (CAS 1451391-32-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627962-250MG |
| cas | 1451391-32-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1591.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1451391-32-4) is a chemical compound with the molecular formula C12H17BBrNO2 and a molecular weight of 297.99 g/mol. IUPAC name: 6-bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GUSAYHQGSSVHMQ-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO2 |
|---|---|
| Molecular weight | 297.99 g/mol |
| IUPAC name | 6-bromo-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GUSAYHQGSSVHMQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)Br)C |
Computed by PubChem (NCBI)