cas: 150780-40-8 — see every product listed under this CAS number, including other names
6-Bromo-2-trifluoromethylimidazo[1,2-a]pyridine, 98%, 98% (CAS 150780-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MV1-100mg |
| cas | 150780-40-8 |
| size | 100mg |
| availability | 4.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1024.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 150780-40-8) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: ZDNCRDVYCJEJPX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | ZDNCRDVYCJEJPX-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)