cas: 438613-29-7 — see every product listed under this CAS number, including other names
6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylic acid 95% (CAS 438613-29-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A106854-250mg |
| cas | 438613-29-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 604.00 Pln | |
| Ambeed | 5g | 1566.31 Pln | |
| Ambeed | 10g | 2461.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A106854 |
6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid (CAS 438613-29-7) is a chemical compound with the molecular formula C9H4BrClO2S and a molecular weight of 291.55 g/mol. IUPAC name: 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: YTGVICLKMKCFAJ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClO2S |
|---|---|
| Molecular weight | 291.55 g/mol |
| IUPAC name | 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | YTGVICLKMKCFAJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)